C25H40F2O4S2 — CID 173449174
8-[4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-9-[2-(1,3-dithiolan-2-yl)ethyl]-1,4-dioxaspiro[4.4]nonane (PubChem CID 173449174) has the molecular formula C25H40F2O4S2 and a molecular weight of 506.72 g/mol. Its IUPAC name is 8-[4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-9-[2-(1,3-dithiolan-2-yl)ethyl]-1,4-dioxaspiro[4.4]nonane.
| Compound Name | 8-[4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-9-[2-(1,3-dithiolan-2-yl)ethyl]-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 173449174 |
| Molecular Formula | C25H40F2O4S2 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 8-[4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-9-[2-(1,3-dithiolan-2-yl)ethyl]-1,4-dioxaspiro[4.4]nonane |
| SMILES | CCCCC(F)(F)C(C=CC1CCC2(OCCO2)C1CCC1SCCS1)OC1CCCCO1 |
| InChI | InChI=1S/C25H40F2O4S2/c1-2-3-12-24(26,27)21(31-22-6-4-5-14-28-22)9-7-19-11-13-25(29-15-16-30-25)20(19)8-10-23-32-17-18-33-23/h7,9,19-23H,2-6,8,10-18H2,1H3 |
| InChIKey | YFWBBGJFXCPSED-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|