C22H37FO4 — CID 70489642
methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate (PubChem CID 70489642) has the molecular formula C22H37FO4 and a molecular weight of 384.53 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
|---|---|
| PubChem CID | 70489642 |
| Molecular Formula | C22H37FO4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aS)-3-fluoro-4-[(E,3S)-3-hydroxyoct-1-enyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2C(F)C(CCCCC(=O)OC)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C22H37FO4/c1-4-5-6-9-16(24)12-13-17-15(2)14-19-21(17)22(23)18(27-19)10-7-8-11-20(25)26-3/h12-13,15-19,21-22,24H,4-11,14H2,1-3H3/b13-12+/t15-,16+,17+,18?,19+,21-,22?/m1/s1 |
| InChIKey | OJOKGSFJUIXAHR-CSWDHWMQSA-N |
| XLogP | 4.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|