C34H48ClNO7 — CID 70522095
(Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]-N,N-dimethylhept-5-enamide (PubChem CID 70522095) has the molecular formula C34H48ClNO7 and a molecular weight of 618.21 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]-N,N-dimethylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]-N,N-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 70522095 |
| Molecular Formula | C34H48ClNO7 |
| Molecular Weight | 618.21 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-3-oxocyclopentyl]-N,N-dimethylhept-5-enamide |
| SMILES | CN(C)C(=O)CCC/C=C\C[C@H]1[C@@H](OC2CCCCO2)CC(=O)[C@@H]1/C=C/[C@H](COc1cccc(Cl)c1)OC1CCCCO1 |
| InChI | InChI=1S/C34H48ClNO7/c1-36(2)32(38)15-6-4-3-5-14-29-28(30(37)23-31(29)43-34-17-8-10-21-40-34)19-18-27(42-33-16-7-9-20-39-33)24-41-26-13-11-12-25(35)22-26/h3,5,11-13,18-19,22,27-29,31,33-34H,4,6-10,14-17,20-21,23-24H2,1-2H3/b5-3-,19-18+/t27-,28-,29-,31+,33?,34?/m1/s1 |
| InChIKey | MGTZWSSDOGGPKC-FCLYRDPMSA-N |
| XLogP | 6.51 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.21 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|