C33H44ClNO9S — CID 13150720
(2E,5Z)-7-[(1R,2R,3R)-2-[(E,3R)-4-(4-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhepta-2,5-dienamide (PubChem CID 13150720) has the molecular formula C33H44ClNO9S and a molecular weight of 666.23 g/mol. Its IUPAC name is (2E,5Z)-7-[(1R,2R,3R)-2-[(E,3R)-4-(4-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhepta-2,5-dienamide.
| Compound Name | (2E,5Z)-7-[(1R,2R,3R)-2-[(E,3R)-4-(4-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhepta-2,5-dienamide |
|---|---|
| PubChem CID | 13150720 |
| Molecular Formula | C33H44ClNO9S |
| Molecular Weight | 666.23 g/mol |
| Exact Mass | 665.24 |
| IUPAC Name | (2E,5Z)-7-[(1R,2R,3R)-2-[(E,3R)-4-(4-chlorophenoxy)-3-(oxan-2-yloxy)but-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentyl]-N-methylsulfonylhepta-2,5-dienamide |
| SMILES | CS(=O)(=O)NC(=O)/C=C/C/C=C\C[C@H]1C(=O)C[C@@H](OC2CCCCO2)[C@@H]1/C=C/[C@H](COc1ccc(Cl)cc1)OC1CCCCO1 |
| InChI | InChI=1S/C33H44ClNO9S/c1-45(38,39)35-31(37)11-5-3-2-4-10-27-28(30(22-29(27)36)44-33-13-7-9-21-41-33)19-18-26(43-32-12-6-8-20-40-32)23-42-25-16-14-24(34)15-17-25/h2,4-5,11,14-19,26-28,30,32-33H,3,6-10,12-13,20-23H2,1H3,(H,35,37)/b4-2-,11-5+,19-18+/t26-,27-,28-,30-,32?,33?/m1/s1 |
| InChIKey | LBYGUJHAHGVPBT-YHDNTPSLSA-N |
| XLogP | 5.27 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.23 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|