C23H46O5Si — CID 18636572
2-[(1R,2R,3R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3,5-dihydroxycyclopentyl]acetic acid (PubChem CID 18636572) has the molecular formula C23H46O5Si and a molecular weight of 430.70 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3,5-dihydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3,5-dihydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 18636572 |
| Molecular Formula | C23H46O5Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-3,5-dihydroxycyclopentyl]acetic acid |
| SMILES | CCCCCC(C)[C@H](CC[C@@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@H]1O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O5Si/c1-8-9-10-11-16(2)21(28-29(6,7)23(3,4)5)13-12-17-18(14-22(26)27)20(25)15-19(17)24/h16-21,24-25H,8-15H2,1-7H3,(H,26,27)/t16?,17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | IJLAZWBBIBZYGP-LDQRCMNXSA-N |
| XLogP | 5.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|