C28H36O6 — CID 22789366
2-[(1R,2R,3R,5S)-5-hydroxy-2-(8-hydroxyoctyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid (PubChem CID 22789366) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-5-hydroxy-2-(8-hydroxyoctyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-5-hydroxy-2-(8-hydroxyoctyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 22789366 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-5-hydroxy-2-(8-hydroxyoctyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](CCCCCCCCO)[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)C[C@@H]1O |
| InChI | InChI=1S/C28H36O6/c29-17-9-4-2-1-3-8-12-23-24(18-27(31)32)25(30)19-26(23)34-28(33)22-15-13-21(14-16-22)20-10-6-5-7-11-20/h5-7,10-11,13-16,23-26,29-30H,1-4,8-9,12,17-19H2,(H,31,32)/t23-,24-,25+,26-/m1/s1 |
| InChIKey | LSHJHDVQKGULQS-FXSWLTOZSA-N |
| XLogP | 5.07 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|