C29H30O6S — CID 70607981
2-[(1R,2R,3S,5S)-5-hydroxy-2-(1-hydroxy-5-thiophen-2-ylpent-1-enyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid (PubChem CID 70607981) has the molecular formula C29H30O6S and a molecular weight of 506.62 g/mol. Its IUPAC name is 2-[(1R,2R,3S,5S)-5-hydroxy-2-(1-hydroxy-5-thiophen-2-ylpent-1-enyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3S,5S)-5-hydroxy-2-(1-hydroxy-5-thiophen-2-ylpent-1-enyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70607981 |
| Molecular Formula | C29H30O6S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-[(1R,2R,3S,5S)-5-hydroxy-2-(1-hydroxy-5-thiophen-2-ylpent-1-enyl)-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(O)=CCCCc2cccs2)[C@@H](OC(=O)c2ccc(-c3ccccc3)cc2)C[C@@H]1O |
| InChI | InChI=1S/C29H30O6S/c30-24(11-5-4-9-22-10-6-16-36-22)28-23(17-27(32)33)25(31)18-26(28)35-29(34)21-14-12-20(13-15-21)19-7-2-1-3-8-19/h1-3,6-8,10-16,23,25-26,28,30-31H,4-5,9,17-18H2,(H,32,33)/t23-,25-,26-,28-/m0/s1 |
| InChIKey | ONVWIFGEKQTQCK-XCDZTUSXSA-N |
| XLogP | 5.88 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|