C30H30O8 — CID 70576911
2-[(1R,2R,3R,5S)-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)-3-(4-phenoxybenzoyl)oxycyclopentyl]acetic acid (PubChem CID 70576911) has the molecular formula C30H30O8 and a molecular weight of 518.56 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)-3-(4-phenoxybenzoyl)oxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)-3-(4-phenoxybenzoyl)oxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70576911 |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)-3-(4-phenoxybenzoyl)oxycyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(O)=CCCOc2ccccc2)[C@H](OC(=O)c2ccc(Oc3ccccc3)cc2)C[C@@H]1O |
| InChI | InChI=1S/C30H30O8/c31-25(12-7-17-36-21-8-3-1-4-9-21)29-24(18-28(33)34)26(32)19-27(29)38-30(35)20-13-15-23(16-14-20)37-22-10-5-2-6-11-22/h1-6,8-16,24,26-27,29,31-32H,7,17-19H2,(H,33,34)/t24-,26-,27+,29-/m0/s1 |
| InChIKey | HRSHJSCXJYXEJO-BUXVXPHYSA-N |
| XLogP | 5.39 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|