C26H30O7 — CID 70572917
2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-methyl-4-phenoxypent-1-enyl)cyclopentyl]acetic acid (PubChem CID 70572917) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-methyl-4-phenoxypent-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-methyl-4-phenoxypent-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70572917 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-methyl-4-phenoxypent-1-enyl)cyclopentyl]acetic acid |
| SMILES | CC(C)(CC=C(O)[C@@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@H]1OC(=O)c1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C26H30O7/c1-26(2,33-18-11-7-4-8-12-18)14-13-20(27)24-19(15-23(29)30)21(28)16-22(24)32-25(31)17-9-5-3-6-10-17/h3-13,19,21-22,24,27-28H,14-16H2,1-2H3,(H,29,30)/t19-,21-,22+,24-/m0/s1 |
| InChIKey | UGAJQJQIPMXXPJ-KZDDHRSZSA-N |
| XLogP | 4.37 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|