C27H56O5Si2 — CID 135019760
(3S,4E,6S,7S,9R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methoxy-4,6-dimethyldodeca-4,11-diene-1,9-diol (PubChem CID 135019760) has the molecular formula C27H56O5Si2 and a molecular weight of 516.91 g/mol. Its IUPAC name is (3S,4E,6S,7S,9R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methoxy-4,6-dimethyldodeca-4,11-diene-1,9-diol.
| Compound Name | (3S,4E,6S,7S,9R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methoxy-4,6-dimethyldodeca-4,11-diene-1,9-diol |
|---|---|
| PubChem CID | 135019760 |
| Molecular Formula | C27H56O5Si2 |
| Molecular Weight | 516.91 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | (3S,4E,6S,7S,9R,10R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methoxy-4,6-dimethyldodeca-4,11-diene-1,9-diol |
| SMILES | C=C[C@@H](OC)[C@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(\C)[C@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O5Si2/c1-15-23(30-10)22(29)19-25(32-34(13,14)27(7,8)9)21(3)18-20(2)24(16-17-28)31-33(11,12)26(4,5)6/h15,18,21-25,28-29H,1,16-17,19H2,2-14H3/b20-18+/t21-,22+,23+,24-,25-/m0/s1 |
| InChIKey | HPWZBYUHQKCMRY-QZQFILEUSA-N |
| XLogP | 6.68 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.91 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|