C28H54O4Si — CID 16726295
(4S,6S)-7-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-6-methoxyhept-1-en-4-ol (PubChem CID 16726295) has the molecular formula C28H54O4Si and a molecular weight of 482.82 g/mol. Its IUPAC name is (4S,6S)-7-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-6-methoxyhept-1-en-4-ol.
| Compound Name | (4S,6S)-7-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-6-methoxyhept-1-en-4-ol |
|---|---|
| PubChem CID | 16726295 |
| Molecular Formula | C28H54O4Si |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.38 |
| IUPAC Name | (4S,6S)-7-[(2R,3S,6S)-6-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-6-methoxyhept-1-en-4-ol |
| SMILES | C=CC[C@H](O)C[C@@H](C[C@H]1O[C@H](C[C@H](/C=C/CC(C)C)O[Si](C)(C)C(C)(C)C)CC[C@@H]1C)OC |
| InChI | InChI=1S/C28H54O4Si/c1-11-13-23(29)18-26(30-8)20-27-22(4)16-17-24(31-27)19-25(15-12-14-21(2)3)32-33(9,10)28(5,6)7/h11-12,15,21-27,29H,1,13-14,16-20H2,2-10H3/b15-12+/t22-,23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | CMANEDHKDWSZON-CEOCXXOTSA-N |
| XLogP | 7.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|