C23H48O4Si2 — CID 135012529
[(3R)-3-[(E,2R,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-5-enyl]oxiran-2-yl]methanol (PubChem CID 135012529) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is [(3R)-3-[(E,2R,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-5-enyl]oxiran-2-yl]methanol.
| Compound Name | [(3R)-3-[(E,2R,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-5-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 135012529 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | [(3R)-3-[(E,2R,3S,4S)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhept-5-enyl]oxiran-2-yl]methanol |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](C[C@H]1OC1CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O4Si2/c1-13-14-18(26-28(9,10)22(3,4)5)17(2)19(15-20-21(16-24)25-20)27-29(11,12)23(6,7)8/h13-14,17-21,24H,15-16H2,1-12H3/b14-13+/t17-,18+,19-,20-,21?/m1/s1 |
| InChIKey | RXOXRCCIKGOCRW-BYXWUUDZSA-N |
| XLogP | 6.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|