C11H20O4 — CID 91282055
(2S,3R,4R)-1-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-3-methylhept-5-ene-2,4-diol (PubChem CID 91282055) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S,3R,4R)-1-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-3-methylhept-5-ene-2,4-diol.
| Compound Name | (2S,3R,4R)-1-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-3-methylhept-5-ene-2,4-diol |
|---|---|
| PubChem CID | 91282055 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (2S,3R,4R)-1-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-3-methylhept-5-ene-2,4-diol |
| SMILES | CC=C[C@@H](O)[C@H](C)[C@@H](O)C[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C11H20O4/c1-3-4-8(13)7(2)9(14)5-10-11(6-12)15-10/h3-4,7-14H,5-6H2,1-2H3/t7-,8+,9-,10-,11-/m0/s1 |
| InChIKey | CDQIQMCJJZXSHH-SSRBZLIGSA-N |
| XLogP | 0.07 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|