C15H26O4 — CID 11380214
(1S,2R,3S,5Z,7R,8R,10S)-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-5-ene-2,7,8-triol (PubChem CID 11380214) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,2R,3S,5Z,7R,8R,10S)-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-5-ene-2,7,8-triol.
| Compound Name | (1S,2R,3S,5Z,7R,8R,10S)-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-5-ene-2,7,8-triol |
|---|---|
| PubChem CID | 11380214 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1S,2R,3S,5Z,7R,8R,10S)-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-5-ene-2,7,8-triol |
| SMILES | C/C1=C/C[C@@H](C(C)C)[C@@H](O)[C@@H]2O[C@@]2(C)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26O4/c1-8(2)10-6-5-9(3)12(17)11(16)7-15(4)14(19-15)13(10)18/h5,8,10-14,16-18H,6-7H2,1-4H3/b9-5-/t10-,11+,12+,13+,14-,15-/m0/s1 |
| InChIKey | UOUMJKKOPWRYPB-QBCLFKMJSA-N |
| XLogP | 1.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|