C22H36O2Si — CID 11035801
(E)-3-[(1R,3R,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl]but-2-en-1-ol (PubChem CID 11035801) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is (E)-3-[(1R,3R,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl]but-2-en-1-ol.
| Compound Name | (E)-3-[(1R,3R,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 11035801 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (E)-3-[(1R,3R,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,5,6,7,7a-hexahydro-2-benzofuran-1-yl]but-2-en-1-ol |
| SMILES | CC1=C2[C@@H]([C@@H](C(C)C)CC1)[C@H](/C(C)=C/CO)O[C@@H]2CC#C[Si](C)(C)C |
| InChI | InChI=1S/C22H36O2Si/c1-15(2)18-11-10-16(3)20-19(9-8-14-25(5,6)7)24-22(21(18)20)17(4)12-13-23/h12,15,18-19,21-23H,9-11,13H2,1-7H3/b17-12+/t18-,19-,21-,22+/m1/s1 |
| InChIKey | QZPAGOILOYPWJF-HCGCNUBFSA-N |
| XLogP | 4.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|