C32H58O2Si2 — CID 11785886
[(Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 11785886) has the molecular formula C32H58O2Si2 and a molecular weight of 530.99 g/mol. Its IUPAC name is [(Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11785886 |
| Molecular Formula | C32H58O2Si2 |
| Molecular Weight | 530.99 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | [(Z)-4-[(1R,3R,3aR,7R,7aR)-4-methyl-7-propan-2-yl-3-(3-trimethylsilylprop-2-ynyl)-1,3,3a,6,7,7a-hexahydro-2-benzofuran-1-yl]pent-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@H]1[C@@H](CC#C[Si](C)(C)C)O[C@H]2/C(C)=C\CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H58O2Si2/c1-22(2)28-19-18-26(9)30-29(17-15-21-35(11,12)13)34-32(31(28)30)27(10)16-14-20-33-36(23(3)4,24(5)6)25(7)8/h16,18,22-25,28-32H,14,17,19-20H2,1-13H3/b27-16-/t28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | YIVMOEGUCIOEOZ-QIGASNQOSA-N |
| XLogP | 9.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.99 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|