C22H38O2Si — CID 101345061
tert-butyl-[[(1R,2R,6R,7R,8R)-3,9-dimethyl-6-propan-2-yl-12-oxatricyclo[6.3.1.02,7]dodeca-3,9-dien-10-yl]oxy]-dimethylsilane (PubChem CID 101345061) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,6R,7R,8R)-3,9-dimethyl-6-propan-2-yl-12-oxatricyclo[6.3.1.02,7]dodeca-3,9-dien-10-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,6R,7R,8R)-3,9-dimethyl-6-propan-2-yl-12-oxatricyclo[6.3.1.02,7]dodeca-3,9-dien-10-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101345061 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | tert-butyl-[[(1R,2R,6R,7R,8R)-3,9-dimethyl-6-propan-2-yl-12-oxatricyclo[6.3.1.02,7]dodeca-3,9-dien-10-yl]oxy]-dimethylsilane |
| SMILES | CC1=CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1CC(O[Si](C)(C)C(C)(C)C)=C(C)[C@@H]2O1 |
| InChI | InChI=1S/C22H38O2Si/c1-13(2)16-11-10-14(3)19-18-12-17(15(4)21(23-18)20(16)19)24-25(8,9)22(5,6)7/h10,13,16,18-21H,11-12H2,1-9H3/t16-,18-,19-,20-,21+/m1/s1 |
| InChIKey | KLXTUHFAFTYUEU-MLZLACJZSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|