C22H38O2Si — CID 139254993
[(1S,9S,10R)-9-ethenyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane (PubChem CID 139254993) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is [(1S,9S,10R)-9-ethenyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,9S,10R)-9-ethenyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139254993 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | [(1S,9S,10R)-9-ethenyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C[C@]12C=CC3CCCC[C@@]3(C[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)O2 |
| InChI | InChI=1S/C22H38O2Si/c1-8-21-14-12-19-11-9-10-13-22(19,24-21)15-20(21)23-25(16(2)3,17(4)5)18(6)7/h8,12,14,16-20H,1,9-11,13,15H2,2-7H3/t19?,20-,21+,22+/m1/s1 |
| InChIKey | FZNUGAUWUFLRCK-FTMYTLCRSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|