C22H40O2Si — CID 139254986
[(1S,2R,6R,9R,10S)-2,9-dimethyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane (PubChem CID 139254986) has the molecular formula C22H40O2Si and a molecular weight of 364.65 g/mol. Its IUPAC name is [(1S,2R,6R,9R,10S)-2,9-dimethyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,2R,6R,9R,10S)-2,9-dimethyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139254986 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | [(1S,2R,6R,9R,10S)-2,9-dimethyl-12-oxatricyclo[7.2.1.01,6]dodec-7-en-10-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@H]1C[C@@]23O[C@]1(C)C=C[C@H]2CCC[C@H]3C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-15(2)25(16(3)4,17(5)6)23-20-14-22-18(7)10-9-11-19(22)12-13-21(20,8)24-22/h12-13,15-20H,9-11,14H2,1-8H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | YOBVXGIEWWAZII-BDHVOXNPSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|