C20H36O2Si — CID 25022822
triethyl-[[(2S,3R,4R)-3-propan-2-yl-2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane (PubChem CID 25022822) has the molecular formula C20H36O2Si and a molecular weight of 336.59 g/mol. Its IUPAC name is triethyl-[[(2S,3R,4R)-3-propan-2-yl-2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane.
| Compound Name | triethyl-[[(2S,3R,4R)-3-propan-2-yl-2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 25022822 |
| Molecular Formula | C20H36O2Si |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | triethyl-[[(2S,3R,4R)-3-propan-2-yl-2-[(E)-prop-1-enyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane |
| SMILES | C/C=C/[C@@H]1OC2=C(CCC2)[C@H](O[Si](CC)(CC)CC)[C@@H]1C(C)C |
| InChI | InChI=1S/C20H36O2Si/c1-7-12-18-19(15(5)6)20(16-13-11-14-17(16)21-18)22-23(8-2,9-3)10-4/h7,12,15,18-20H,8-11,13-14H2,1-6H3/b12-7+/t18-,19+,20-/m0/s1 |
| InChIKey | LYDZVQSMSODGRF-OOADNZSESA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|