C21H36O2Si2 — CID 135015875
tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane (PubChem CID 135015875) has the molecular formula C21H36O2Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 135015875 |
| Molecular Formula | C21H36O2Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-4-trimethylsilylbut-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](/C=C\C#C[Si](C)(C)C)OC2=C1CCC2 |
| InChI | InChI=1S/C21H36O2Si2/c1-21(2,3)25(7,8)23-20-16-17(12-9-10-15-24(4,5)6)22-19-14-11-13-18(19)20/h9,12,17,20H,11,13-14,16H2,1-8H3/b12-9-/t17-,20+/m0/s1 |
| InChIKey | IESZYDVEJZFTCB-ULHUWXCASA-N |
| XLogP | 6.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|