C22H36O2Si — CID 135016358
tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-oct-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane (PubChem CID 135016358) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-oct-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-oct-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 135016358 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(2R,4R)-2-[(Z)-oct-1-en-3-ynyl]-2,3,4,5,6,7-hexahydrocyclopenta[b]pyran-4-yl]oxy]silane |
| SMILES | CCCCC#C/C=C\[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C2=C(CCC2)O1 |
| InChI | InChI=1S/C22H36O2Si/c1-7-8-9-10-11-12-14-18-17-21(19-15-13-16-20(19)23-18)24-25(5,6)22(2,3)4/h12,14,18,21H,7-9,13,15-17H2,1-6H3/b14-12-/t18-,21+/m0/s1 |
| InChIKey | XHETWHFAOWWGOQ-FWWQKLGASA-N |
| XLogP | 6.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|