C25H43IO2Si — CID 16732040
[(E)-4-[(2R,3aS,4R,7aS)-6-methyl-4-prop-1-en-2-yl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-2-yl]-3-iodobut-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 16732040) has the molecular formula C25H43IO2Si and a molecular weight of 530.61 g/mol. Its IUPAC name is [(E)-4-[(2R,3aS,4R,7aS)-6-methyl-4-prop-1-en-2-yl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-2-yl]-3-iodobut-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E)-4-[(2R,3aS,4R,7aS)-6-methyl-4-prop-1-en-2-yl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-2-yl]-3-iodobut-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 16732040 |
| Molecular Formula | C25H43IO2Si |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [(E)-4-[(2R,3aS,4R,7aS)-6-methyl-4-prop-1-en-2-yl-2,3,3a,4,5,7a-hexahydro-1-benzofuran-2-yl]-3-iodobut-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | C=C(C)[C@@H]1CC(C)=C[C@H]2O[C@@H](/C=C(/I)CCO[Si](C(C)C)(C(C)C)C(C)C)C[C@H]21 |
| InChI | InChI=1S/C25H43IO2Si/c1-16(2)23-12-20(9)13-25-24(23)15-22(28-25)14-21(26)10-11-27-29(17(3)4,18(5)6)19(7)8/h13-14,17-19,22-25H,1,10-12,15H2,2-9H3/b21-14+/t22-,23-,24-,25+/m0/s1 |
| InChIKey | VRUMMONDDWDJDH-KVBPPFNTSA-N |
| XLogP | 8.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|