C21H38OSi2 — CID 11954549
trimethyl-[(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane (PubChem CID 11954549) has the molecular formula C21H38OSi2 and a molecular weight of 362.71 g/mol. Its IUPAC name is trimethyl-[(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane.
| Compound Name | trimethyl-[(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane |
|---|---|
| PubChem CID | 11954549 |
| Molecular Formula | C21H38OSi2 |
| Molecular Weight | 362.71 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | trimethyl-[(4S)-4-methyl-2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane |
| SMILES | C=C(C[C@H](C)C[C@@H]1CC=C[C@@H](CC#C[Si](C)(C)C)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C21H38OSi2/c1-18(15-19(2)17-24(6,7)8)16-21-12-9-11-20(22-21)13-10-14-23(3,4)5/h9,11,18,20-21H,2,12-13,15-17H2,1,3-8H3/t18-,20-,21-/m0/s1 |
| InChIKey | ROZYVUYAFFDOTF-JBACZVJFSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|