C20H36OSi2 — CID 11653175
trimethyl-[2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane (PubChem CID 11653175) has the molecular formula C20H36OSi2 and a molecular weight of 348.68 g/mol. Its IUPAC name is trimethyl-[2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane.
| Compound Name | trimethyl-[2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane |
|---|---|
| PubChem CID | 11653175 |
| Molecular Formula | C20H36OSi2 |
| Molecular Weight | 348.68 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | trimethyl-[2-methylidene-5-[(2R,6R)-6-(3-trimethylsilylprop-2-ynyl)-3,6-dihydro-2H-pyran-2-yl]pentyl]silane |
| SMILES | C=C(CCC[C@@H]1CC=C[C@@H](CC#C[Si](C)(C)C)O1)C[Si](C)(C)C |
| InChI | InChI=1S/C20H36OSi2/c1-18(17-23(5,6)7)11-8-12-19-13-9-14-20(21-19)15-10-16-22(2,3)4/h9,14,19-20H,1,8,11-13,15,17H2,2-7H3/t19-,20+/m1/s1 |
| InChIKey | CIGKDURYUYLIBH-UXHICEINSA-N |
| XLogP | 6.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|