C21H38OSi — CID 46895237
1-(cyclohexen-1-yl)non-2-ynoxy-triethylsilane (PubChem CID 46895237) has the molecular formula C21H38OSi and a molecular weight of 334.62 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)non-2-ynoxy-triethylsilane.
| Compound Name | 1-(cyclohexen-1-yl)non-2-ynoxy-triethylsilane |
|---|---|
| PubChem CID | 46895237 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 1-(cyclohexen-1-yl)non-2-ynoxy-triethylsilane |
| SMILES | CCCCCCC#CC(O[Si](CC)(CC)CC)C1=CCCCC1 |
| InChI | InChI=1S/C21H38OSi/c1-5-9-10-11-12-16-19-21(20-17-14-13-15-18-20)22-23(6-2,7-3)8-4/h17,21H,5-15,18H2,1-4H3 |
| InChIKey | PQYXFGVUUFYNIC-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|