C19H32OSi2 — CID 11393435
[(1S)-cyclohex-2-en-1-yl]oxy-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane (PubChem CID 11393435) has the molecular formula C19H32OSi2 and a molecular weight of 332.64 g/mol. Its IUPAC name is [(1S)-cyclohex-2-en-1-yl]oxy-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane.
| Compound Name | [(1S)-cyclohex-2-en-1-yl]oxy-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane |
|---|---|
| PubChem CID | 11393435 |
| Molecular Formula | C19H32OSi2 |
| Molecular Weight | 332.64 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(1S)-cyclohex-2-en-1-yl]oxy-dimethyl-(8-trimethylsilylocta-1,7-diynyl)silane |
| SMILES | C[Si](C)(C)C#CCCCCC#C[Si](C)(C)O[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C19H32OSi2/c1-21(2,3)17-13-8-6-7-9-14-18-22(4,5)20-19-15-11-10-12-16-19/h11,15,19H,6-10,12,16H2,1-5H3/t19-/m1/s1 |
| InChIKey | OXXVPYYKDDRWEV-LJQANCHMSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|