C23H44OSi2 — CID 135066672
triethyl-[(2E)-1-pent-1-ynyl-3-triethylsilylhexa-2,5-dienoxy]silane (PubChem CID 135066672) has the molecular formula C23H44OSi2 and a molecular weight of 392.78 g/mol. Its IUPAC name is triethyl-[(2E)-1-pent-1-ynyl-3-triethylsilylhexa-2,5-dienoxy]silane.
| Compound Name | triethyl-[(2E)-1-pent-1-ynyl-3-triethylsilylhexa-2,5-dienoxy]silane |
|---|---|
| PubChem CID | 135066672 |
| Molecular Formula | C23H44OSi2 |
| Molecular Weight | 392.78 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | triethyl-[(2E)-1-pent-1-ynyl-3-triethylsilylhexa-2,5-dienoxy]silane |
| SMILES | C=CC/C(=C\C(C#CCCC)O[Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H44OSi2/c1-9-17-18-20-22(24-26(14-6,15-7)16-8)21-23(19-10-2)25(11-3,12-4)13-5/h10,21-22H,2,9,11-17,19H2,1,3-8H3/b23-21+ |
| InChIKey | CVJGFXMDPDCROM-XTQSDGFTSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.78 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|