C16H28OSi — CID 53359090
tert-butyl-[(3Z,5S,7Z)-deca-3,7-dien-1-yn-5-yl]oxy-dimethylsilane (PubChem CID 53359090) has the molecular formula C16H28OSi and a molecular weight of 264.48 g/mol. Its IUPAC name is tert-butyl-[(3Z,5S,7Z)-deca-3,7-dien-1-yn-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3Z,5S,7Z)-deca-3,7-dien-1-yn-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 53359090 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | tert-butyl-[(3Z,5S,7Z)-deca-3,7-dien-1-yn-5-yl]oxy-dimethylsilane |
| SMILES | C#C/C=C\[C@H](C/C=C\CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H28OSi/c1-8-10-12-14-15(13-11-9-2)17-18(6,7)16(3,4)5/h2,10-13,15H,8,14H2,1,3-7H3/b12-10-,13-11-/t15-/m1/s1 |
| InChIKey | QIBCTJJSGMMQMP-JAFTVXISSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|