C19H34OSi — CID 11771207
[(3S,4R,5E)-2,3-dimethylocta-1,5-dien-7-yn-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11771207) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is [(3S,4R,5E)-2,3-dimethylocta-1,5-dien-7-yn-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3S,4R,5E)-2,3-dimethylocta-1,5-dien-7-yn-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11771207 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | [(3S,4R,5E)-2,3-dimethylocta-1,5-dien-7-yn-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C#C/C=C/[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C(=C)C |
| InChI | InChI=1S/C19H34OSi/c1-11-12-13-19(18(10)14(2)3)20-21(15(4)5,16(6)7)17(8)9/h1,12-13,15-19H,2H2,3-10H3/b13-12+/t18-,19+/m0/s1 |
| InChIKey | LAMVBXWYTZYHBI-UBJZUDALSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|