C16H32OSi — CID 135044084
tert-butyl-dimethyl-[(3E)-4-propan-2-ylhepta-3,6-dien-2-yl]oxysilane (PubChem CID 135044084) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3E)-4-propan-2-ylhepta-3,6-dien-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3E)-4-propan-2-ylhepta-3,6-dien-2-yl]oxysilane |
|---|---|
| PubChem CID | 135044084 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | tert-butyl-dimethyl-[(3E)-4-propan-2-ylhepta-3,6-dien-2-yl]oxysilane |
| SMILES | C=CC/C(=C\C(C)O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H32OSi/c1-10-11-15(13(2)3)12-14(4)17-18(8,9)16(5,6)7/h10,12-14H,1,11H2,2-9H3/b15-12+ |
| InChIKey | RVJRMTUAFOFVGS-NTCAYCPXSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|