C27H48OSi — CID 134875143
tri(propan-2-yl)-[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yn-4-yl]oxysilane (PubChem CID 134875143) has the molecular formula C27H48OSi and a molecular weight of 416.77 g/mol. Its IUPAC name is tri(propan-2-yl)-[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yn-4-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yn-4-yl]oxysilane |
|---|---|
| PubChem CID | 134875143 |
| Molecular Formula | C27H48OSi |
| Molecular Weight | 416.77 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | tri(propan-2-yl)-[(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yn-4-yl]oxysilane |
| SMILES | C#CCC(/C=C(\C)CC/C=C(\C)CCC=C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H48OSi/c1-12-15-27(28-29(22(4)5,23(6)7)24(8)9)20-26(11)19-14-18-25(10)17-13-16-21(2)3/h1,16,18,20,22-24,27H,13-15,17,19H2,2-11H3/b25-18+,26-20+ |
| InChIKey | LPNUKEJQVHLZPI-ICRKYIHISA-N |
| XLogP | 8.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.77 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|