C11H20OSi — CID 11651317
(6S)-6-[(E)-but-2-en-2-yl]-2,2,5-trimethyl-3,6-dihydrooxasiline (PubChem CID 11651317) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is (6S)-6-[(E)-but-2-en-2-yl]-2,2,5-trimethyl-3,6-dihydrooxasiline.
| Compound Name | (6S)-6-[(E)-but-2-en-2-yl]-2,2,5-trimethyl-3,6-dihydrooxasiline |
|---|---|
| PubChem CID | 11651317 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (6S)-6-[(E)-but-2-en-2-yl]-2,2,5-trimethyl-3,6-dihydrooxasiline |
| SMILES | C/C=C(\C)[C@@H]1O[Si](C)(C)CC=C1C |
| InChI | InChI=1S/C11H20OSi/c1-6-9(2)11-10(3)7-8-13(4,5)12-11/h6-7,11H,8H2,1-5H3/b9-6+/t11-/m0/s1 |
| InChIKey | OOOMJVOVSWRMFV-LAHYYIKRSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|