C19H32OSi — CID 122386867
tert-butyl-dimethyl-[(3Z,5S,7Z,10Z)-trideca-3,7,10-trien-1-yn-5-yl]oxysilane (PubChem CID 122386867) has the molecular formula C19H32OSi and a molecular weight of 304.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3Z,5S,7Z,10Z)-trideca-3,7,10-trien-1-yn-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3Z,5S,7Z,10Z)-trideca-3,7,10-trien-1-yn-5-yl]oxysilane |
|---|---|
| PubChem CID | 122386867 |
| Molecular Formula | C19H32OSi |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl-dimethyl-[(3Z,5S,7Z,10Z)-trideca-3,7,10-trien-1-yn-5-yl]oxysilane |
| SMILES | C#C/C=C\[C@H](C/C=C\C/C=C\CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32OSi/c1-8-10-12-13-14-15-17-18(16-11-9-2)20-21(6,7)19(3,4)5/h2,10-12,14-16,18H,8,13,17H2,1,3-7H3/b12-10-,15-14-,16-11-/t18-/m1/s1 |
| InChIKey | TXFPGFHCXQKMDJ-UFSTXDTCSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|