C15H26OSi — CID 11651729
ethynyl-[(3R,4E)-4-methylhexa-1,4-dien-3-yl]oxy-di(propan-2-yl)silane (PubChem CID 11651729) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is ethynyl-[(3R,4E)-4-methylhexa-1,4-dien-3-yl]oxy-di(propan-2-yl)silane.
| Compound Name | ethynyl-[(3R,4E)-4-methylhexa-1,4-dien-3-yl]oxy-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 11651729 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | ethynyl-[(3R,4E)-4-methylhexa-1,4-dien-3-yl]oxy-di(propan-2-yl)silane |
| SMILES | C#C[Si](O[C@H](C=C)/C(C)=C/C)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H26OSi/c1-9-14(8)15(10-2)16-17(11-3,12(4)5)13(6)7/h3,9-10,12-13,15H,2H2,1,4-8H3/b14-9+/t15-/m1/s1 |
| InChIKey | MCZWLLDMRLZBEJ-AAWPKVBNSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|