C24H48OSi2 — CID 135020840
triethyl-[(2E)-1-(3-methyl-2-methylidenebutyl)-3-triethylsilylhexa-2,5-dienoxy]silane (PubChem CID 135020840) has the molecular formula C24H48OSi2 and a molecular weight of 408.82 g/mol. Its IUPAC name is triethyl-[(2E)-1-(3-methyl-2-methylidenebutyl)-3-triethylsilylhexa-2,5-dienoxy]silane.
| Compound Name | triethyl-[(2E)-1-(3-methyl-2-methylidenebutyl)-3-triethylsilylhexa-2,5-dienoxy]silane |
|---|---|
| PubChem CID | 135020840 |
| Molecular Formula | C24H48OSi2 |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | triethyl-[(2E)-1-(3-methyl-2-methylidenebutyl)-3-triethylsilylhexa-2,5-dienoxy]silane |
| SMILES | C=CC/C(=C\C(CC(=C)C(C)C)O[Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H48OSi2/c1-11-18-24(26(12-2,13-3)14-4)20-23(19-22(10)21(8)9)25-27(15-5,16-6)17-7/h11,20-21,23H,1,10,12-19H2,2-9H3/b24-20+ |
| InChIKey | AAQGYTFAYPSFLC-HIXSDJFHSA-N |
| XLogP | 8.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|