C16H32OSi2 — CID 11358411
tert-butyl-[(1R,4S)-4-ethenyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane (PubChem CID 11358411) has the molecular formula C16H32OSi2 and a molecular weight of 296.60 g/mol. Its IUPAC name is tert-butyl-[(1R,4S)-4-ethenyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,4S)-4-ethenyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11358411 |
| Molecular Formula | C16H32OSi2 |
| Molecular Weight | 296.60 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | tert-butyl-[(1R,4S)-4-ethenyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C=C1[Si](C)(C)C |
| InChI | InChI=1S/C16H32OSi2/c1-10-13-11-14(12-15(13)18(5,6)7)17-19(8,9)16(2,3)4/h10,12-14H,1,11H2,2-9H3/t13-,14-/m1/s1 |
| InChIKey | JUCZXBVBCMKWKK-ZIAGYGMSSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|