C18H36OSi2 — CID 11255807
tert-butyl-[(1S,4R)-4-ethenyl-5,5-dimethyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane (PubChem CID 11255807) has the molecular formula C18H36OSi2 and a molecular weight of 324.66 g/mol. Its IUPAC name is tert-butyl-[(1S,4R)-4-ethenyl-5,5-dimethyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,4R)-4-ethenyl-5,5-dimethyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11255807 |
| Molecular Formula | C18H36OSi2 |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | tert-butyl-[(1S,4R)-4-ethenyl-5,5-dimethyl-3-trimethylsilylcyclopent-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1C([Si](C)(C)C)=C[C@H](O[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C18H36OSi2/c1-12-14-15(20(7,8)9)13-16(18(14,5)6)19-21(10,11)17(2,3)4/h12-14,16H,1H2,2-11H3/t14-,16-/m0/s1 |
| InChIKey | SDIFWYJNSSMOSM-HOCLYGCPSA-N |
| XLogP | 6.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|