C20H42O2Si2 — CID 134951609
tert-butyl-[(1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane (PubChem CID 134951609) has the molecular formula C20H42O2Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is tert-butyl-[(1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134951609 |
| Molecular Formula | C20H42O2Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | tert-butyl-[(1S,3S)-2,2-dimethyl-1-[(E)-prop-1-enyl]-3-trimethylsilyloxyhex-5-enoxy]-dimethylsilane |
| SMILES | C=CC[C@H](O[Si](C)(C)C)C(C)(C)[C@H](/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O2Si2/c1-13-15-17(21-23(8,9)10)20(6,7)18(16-14-2)22-24(11,12)19(3,4)5/h13-14,16-18H,1,15H2,2-12H3/b16-14+/t17-,18-/m0/s1 |
| InChIKey | AUHRMYWJBUOYIX-YERQVDBCSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|