C25H49O3Si2- — CID 135046756
(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-olate (PubChem CID 135046756) has the molecular formula C25H49O3Si2- and a molecular weight of 453.84 g/mol. Its IUPAC name is (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-olate.
| Compound Name | (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-olate |
|---|---|
| PubChem CID | 135046756 |
| Molecular Formula | C25H49O3Si2- |
| Molecular Weight | 453.84 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopenten-1-olate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1C=C([O-])C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O3Si2/c1-12-13-14-15-22(27-29(8,9)24(2,3)4)17-16-20-18-21(26)19-23(20)28-30(10,11)25(5,6)7/h16-18,20,22-23,26H,12-15,19H2,1-11H3/p-1/b17-16+/t20-,22+,23-/m1/s1 |
| InChIKey | OTJFZLVYLXJNKC-OAVCZXIDSA-M |
| XLogP | 7.17 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|