C33H64O3Si3 — CID 18598961
tert-butyl-[(3R,4R)-2-but-1-ynyl-3-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oxy-dimethylsilane (PubChem CID 18598961) has the molecular formula C33H64O3Si3 and a molecular weight of 593.13 g/mol. Its IUPAC name is tert-butyl-[(3R,4R)-2-but-1-ynyl-3-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4R)-2-but-1-ynyl-3-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 18598961 |
| Molecular Formula | C33H64O3Si3 |
| Molecular Weight | 593.13 g/mol |
| Exact Mass | 592.42 |
| IUPAC Name | tert-butyl-[(3R,4R)-2-but-1-ynyl-3-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]oxy-dimethylsilane |
| SMILES | CCC#CC1=C(O[Si](C)(C)C(C)(C)C)C[C@@H](O[Si](CC)(CC)CC)[C@@H]1/C=C/CC(C)(CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C33H64O3Si3/c1-15-20-23-28-29(24-22-26-33(9,25-21-16-2)36-37(10,11)12)31(35-39(17-3,18-4)19-5)27-30(28)34-38(13,14)32(6,7)8/h22,24,29,31H,15-19,21,25-27H2,1-14H3/b24-22+/t29-,31-,33?/m1/s1 |
| InChIKey | CTYZUDWYSWTHKW-QUCXWHFRSA-N |
| XLogP | 10.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.13 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|