C37H71FO4Si3 — CID 70440863
8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-fluorooct-6-yn-2-ol (PubChem CID 70440863) has the molecular formula C37H71FO4Si3 and a molecular weight of 683.23 g/mol. Its IUPAC name is 8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-fluorooct-6-yn-2-ol.
| Compound Name | 8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-fluorooct-6-yn-2-ol |
|---|---|
| PubChem CID | 70440863 |
| Molecular Formula | C37H71FO4Si3 |
| Molecular Weight | 683.23 g/mol |
| Exact Mass | 682.46 |
| IUPAC Name | 8-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-fluorooct-6-yn-2-ol |
| SMILES | CCCCC(C)(C/C=C/[C@@H]1C(CC#CC(F)CCC(C)O)=C(O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C37H71FO4Si3/c1-15-19-27-37(9,42-43(10,11)12)28-21-24-33-32(23-20-22-31(38)26-25-30(5)39)34(40-44(13,14)36(6,7)8)29-35(33)41-45(16-2,17-3)18-4/h21,24,30-31,33,35,39H,15-19,23,25-29H2,1-14H3/b24-21+/t30?,31?,33-,35-,37?/m1/s1 |
| InChIKey | HRXPLHLUYQCYES-HZVJTOKPSA-N |
| XLogP | 11.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.23 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|