C39H74O6Si3 — CID 70490073
[1-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-7-hydroxyoct-2-yn-4-yl] acetate (PubChem CID 70490073) has the molecular formula C39H74O6Si3 and a molecular weight of 723.27 g/mol. Its IUPAC name is [1-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-7-hydroxyoct-2-yn-4-yl] acetate.
| Compound Name | [1-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-7-hydroxyoct-2-yn-4-yl] acetate |
|---|---|
| PubChem CID | 70490073 |
| Molecular Formula | C39H74O6Si3 |
| Molecular Weight | 723.27 g/mol |
| Exact Mass | 722.48 |
| IUPAC Name | [1-[(4R,5R)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-7-hydroxyoct-2-yn-4-yl] acetate |
| SMILES | CCCCC(C)(C/C=C/[C@@H]1C(CC#CC(CCC(C)O)OC(C)=O)=C(O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C39H74O6Si3/c1-16-20-28-39(10,45-46(11,12)13)29-22-25-35-34(24-21-23-33(42-32(6)41)27-26-31(5)40)36(43-47(14,15)38(7,8)9)30-37(35)44-48(17-2,18-3)19-4/h22,25,31,33,35,37,40H,16-20,24,26-30H2,1-15H3/b25-22+/t31?,33?,35-,37-,39?/m1/s1 |
| InChIKey | QBYMLVMHWDPEPF-RNLFWXKPSA-N |
| XLogP | 10.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.27 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|