C30H66O3Si4 — CID 166440883
triethyl-[(3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]silane (PubChem CID 166440883) has the molecular formula C30H66O3Si4 and a molecular weight of 587.20 g/mol. Its IUPAC name is triethyl-[(3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]silane.
| Compound Name | triethyl-[(3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]silane |
|---|---|
| PubChem CID | 166440883 |
| Molecular Formula | C30H66O3Si4 |
| Molecular Weight | 587.20 g/mol |
| Exact Mass | 586.41 |
| IUPAC Name | triethyl-[(3R,4S,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohexen-1-yl]silane |
| SMILES | CC[Si](CC)(CC)C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C30H66O3Si4/c1-19-37(20-2,21-3)24-22-25(31-34(13,14)28(4,5)6)27(33-36(17,18)30(10,11)12)26(23-24)32-35(15,16)29(7,8)9/h22,25-27H,19-21,23H2,1-18H3/t25-,26-,27-/m1/s1 |
| InChIKey | JENNJGIVKBMPDA-ZONZVBGPSA-N |
| XLogP | 10.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.20 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|