C24H54O2Si3 — CID 135002741
tert-butyl-dimethyl-[(Z)-4-trimethylsilyl-3-tri(propan-2-yl)silyloxyhex-4-en-2-yl]oxysilane (PubChem CID 135002741) has the molecular formula C24H54O2Si3 and a molecular weight of 458.95 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-4-trimethylsilyl-3-tri(propan-2-yl)silyloxyhex-4-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z)-4-trimethylsilyl-3-tri(propan-2-yl)silyloxyhex-4-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 135002741 |
| Molecular Formula | C24H54O2Si3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-4-trimethylsilyl-3-tri(propan-2-yl)silyloxyhex-4-en-2-yl]oxysilane |
| SMILES | C/C=C(/C(O[Si](C(C)C)(C(C)C)C(C)C)C(C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H54O2Si3/c1-17-22(27(12,13)14)23(21(8)25-28(15,16)24(9,10)11)26-29(18(2)3,19(4)5)20(6)7/h17-21,23H,1-16H3/b22-17- |
| InChIKey | WCWCGHQVDOQXMU-XLNRJJMWSA-N |
| XLogP | 8.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|