C22H48O2Si2 — CID 11475089
tert-butyl-dimethyl-[(Z,2S)-1-triethylsilyloxydec-4-en-2-yl]oxysilane (PubChem CID 11475089) has the molecular formula C22H48O2Si2 and a molecular weight of 400.80 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,2S)-1-triethylsilyloxydec-4-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z,2S)-1-triethylsilyloxydec-4-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 11475089 |
| Molecular Formula | C22H48O2Si2 |
| Molecular Weight | 400.80 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,2S)-1-triethylsilyloxydec-4-en-2-yl]oxysilane |
| SMILES | CCCCC/C=C\C[C@@H](CO[Si](CC)(CC)CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O2Si2/c1-10-14-15-16-17-18-19-21(24-25(8,9)22(5,6)7)20-23-26(11-2,12-3)13-4/h17-18,21H,10-16,19-20H2,1-9H3/b18-17-/t21-/m0/s1 |
| InChIKey | SSUHHIHGMXQGEQ-OGLOHFSISA-N |
| XLogP | 7.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.80 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|