C20H44OSi2 — CID 11382734
tert-butyl-dimethyl-[(E)-6-trimethylsilylundec-4-enoxy]silane (PubChem CID 11382734) has the molecular formula C20H44OSi2 and a molecular weight of 356.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-6-trimethylsilylundec-4-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-6-trimethylsilylundec-4-enoxy]silane |
|---|---|
| PubChem CID | 11382734 |
| Molecular Formula | C20H44OSi2 |
| Molecular Weight | 356.74 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-6-trimethylsilylundec-4-enoxy]silane |
| SMILES | CCCCCC(/C=C/CCCO[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H44OSi2/c1-10-11-13-16-19(22(5,6)7)17-14-12-15-18-21-23(8,9)20(2,3)4/h14,17,19H,10-13,15-16,18H2,1-9H3/b17-14+ |
| InChIKey | LYVKFIYQMBEJTQ-SAPNQHFASA-N |
| XLogP | 7.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|