C32H66O3Si3 — CID 11731540
[(2S,3Z,5E,7R,9Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2-methylundeca-3,5,9-trienoxy]-triethylsilane (PubChem CID 11731540) has the molecular formula C32H66O3Si3 and a molecular weight of 583.14 g/mol. Its IUPAC name is [(2S,3Z,5E,7R,9Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2-methylundeca-3,5,9-trienoxy]-triethylsilane.
| Compound Name | [(2S,3Z,5E,7R,9Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2-methylundeca-3,5,9-trienoxy]-triethylsilane |
|---|---|
| PubChem CID | 11731540 |
| Molecular Formula | C32H66O3Si3 |
| Molecular Weight | 583.14 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | [(2S,3Z,5E,7R,9Z)-7,11-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethyl-2-methylundeca-3,5,9-trienoxy]-triethylsilane |
| SMILES | CCC(=C/[C@H](C)CO[Si](CC)(CC)CC)/C=C/[C@@H](C/C=C\CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H66O3Si3/c1-16-29(26-28(5)27-34-38(17-2,18-3)19-4)23-24-30(35-37(14,15)32(9,10)11)22-20-21-25-33-36(12,13)31(6,7)8/h20-21,23-24,26,28,30H,16-19,22,25,27H2,1-15H3/b21-20-,24-23+,29-26-/t28-,30+/m0/s1 |
| InChIKey | YMMMBQRXGQUBRK-YVYBJQPWSA-N |
| XLogP | 10.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.14 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|