C24H46O2Si2 — CID 134887146
(4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-1,4,6,10-tetraen-3-ol (PubChem CID 134887146) has the molecular formula C24H46O2Si2 and a molecular weight of 422.80 g/mol. Its IUPAC name is (4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-1,4,6,10-tetraen-3-ol.
| Compound Name | (4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-1,4,6,10-tetraen-3-ol |
|---|---|
| PubChem CID | 134887146 |
| Molecular Formula | C24H46O2Si2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (4E,6E,8R,9S,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-11-trimethylsilylundeca-1,4,6,10-tetraen-3-ol |
| SMILES | C=C(C)C(O)/C(C)=C/C(C)=C/[C@@H](C)[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O2Si2/c1-18(2)23(25)21(5)17-19(3)16-20(4)22(14-15-27(9,10)11)26-28(12,13)24(6,7)8/h14-17,20,22-23,25H,1H2,2-13H3/b15-14+,19-16+,21-17+/t20-,22-,23?/m1/s1 |
| InChIKey | AKHQUGJEAZVIOE-HOJUFRPZSA-N |
| XLogP | 7.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|