C26H52O2Si2 — CID 11698150
(E,3R,4R,7R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol (PubChem CID 11698150) has the molecular formula C26H52O2Si2 and a molecular weight of 452.87 g/mol. Its IUPAC name is (E,3R,4R,7R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol.
| Compound Name | (E,3R,4R,7R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol |
|---|---|
| PubChem CID | 11698150 |
| Molecular Formula | C26H52O2Si2 |
| Molecular Weight | 452.87 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | (E,3R,4R,7R)-8-[tert-butyl(dimethyl)silyl]oxy-3,5,7-trimethyl-1-tri(propan-2-yl)silyloct-5-en-1-yn-4-ol |
| SMILES | C/C(=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H52O2Si2/c1-19(2)30(20(3)4,21(5)6)16-15-23(8)25(27)24(9)17-22(7)18-28-29(13,14)26(10,11)12/h17,19-23,25,27H,18H2,1-14H3/b24-17+/t22-,23-,25-/m1/s1 |
| InChIKey | BTCYNOOZLIBKDC-CRMGVGRISA-N |
| XLogP | 7.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.87 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|